C29H41N3O5S — CID 22394794
1-N-(3,4-dihydroxy-7-methylsulfanyl-1-phenylheptan-2-yl)-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide (PubChem CID 22394794) has the molecular formula C29H41N3O5S and a molecular weight of 543.73 g/mol. Its IUPAC name is 1-N-(3,4-dihydroxy-7-methylsulfanyl-1-phenylheptan-2-yl)-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide.
| Compound Name | 1-N-(3,4-dihydroxy-7-methylsulfanyl-1-phenylheptan-2-yl)-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 22394794 |
| Molecular Formula | C29H41N3O5S |
| Molecular Weight | 543.73 g/mol |
| Exact Mass | 543.28 |
| IUPAC Name | 1-N-(3,4-dihydroxy-7-methylsulfanyl-1-phenylheptan-2-yl)-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C(N)=O)cc(C(=O)NC(Cc2ccccc2)C(O)C(O)CCCSC)c1 |
| InChI | InChI=1S/C29H41N3O5S/c1-4-13-32(14-5-2)29(37)23-18-21(27(30)35)17-22(19-23)28(36)31-24(16-20-10-7-6-8-11-20)26(34)25(33)12-9-15-38-3/h6-8,10-11,17-19,24-26,33-34H,4-5,9,12-16H2,1-3H3,(H2,30,35)(H,31,36) |
| InChIKey | MRBCTORXNKUCGN-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.73 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|