C28H39N5O5 — CID 159803296
1-N-(7-cyano-3,4-dihydroxy-1-pyridin-4-ylheptan-2-yl)-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide;molecular hydrogen (PubChem CID 159803296) has the molecular formula C28H39N5O5 and a molecular weight of 525.65 g/mol. Its IUPAC name is 1-N-(7-cyano-3,4-dihydroxy-1-pyridin-4-ylheptan-2-yl)-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide;molecular hydrogen.
| Compound Name | 1-N-(7-cyano-3,4-dihydroxy-1-pyridin-4-ylheptan-2-yl)-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide;molecular hydrogen |
|---|---|
| PubChem CID | 159803296 |
| Molecular Formula | C28H39N5O5 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | 1-N-(7-cyano-3,4-dihydroxy-1-pyridin-4-ylheptan-2-yl)-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide;molecular hydrogen |
| SMILES | CCCN(CCC)C(=O)c1cc(C(N)=O)cc(C(=O)NC(Cc2ccncc2)C(O)C(O)CCCC#N)c1.[H][H] |
| InChI | InChI=1S/C28H37N5O5.H2/c1-3-13-33(14-4-2)28(38)22-17-20(26(30)36)16-21(18-22)27(37)32-23(15-19-8-11-31-12-9-19)25(35)24(34)7-5-6-10-29;/h8-9,11-12,16-18,23-25,34-35H,3-7,13-15H2,1-2H3,(H2,30,36)(H,32,37);1H |
| InChIKey | NKBJUFFFPHPEFP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 169.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|