C34H42N4O6 — CID 10188968
1-N-[(2S,3R,4R,5R)-5-benzamido-3,4-dihydroxy-1-phenylhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide (PubChem CID 10188968) has the molecular formula C34H42N4O6 and a molecular weight of 602.73 g/mol. Its IUPAC name is 1-N-[(2S,3R,4R,5R)-5-benzamido-3,4-dihydroxy-1-phenylhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide.
| Compound Name | 1-N-[(2S,3R,4R,5R)-5-benzamido-3,4-dihydroxy-1-phenylhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 10188968 |
| Molecular Formula | C34H42N4O6 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.31 |
| IUPAC Name | 1-N-[(2S,3R,4R,5R)-5-benzamido-3,4-dihydroxy-1-phenylhexan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C(N)=O)cc(C(=O)N[C@@H](Cc2ccccc2)[C@@H](O)[C@H](O)[C@@H](C)NC(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C34H42N4O6/c1-4-16-38(17-5-2)34(44)27-20-25(31(35)41)19-26(21-27)33(43)37-28(18-23-12-8-6-9-13-23)30(40)29(39)22(3)36-32(42)24-14-10-7-11-15-24/h6-15,19-22,28-30,39-40H,4-5,16-18H2,1-3H3,(H2,35,41)(H,36,42)(H,37,43)/t22-,28+,29-,30-/m1/s1 |
| InChIKey | RUHDXBPZNPOTMI-JMFHHTCZSA-N |
| XLogP | 2.93 |
| TPSA | 162.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |