C36H49N5O7S — CID 23398655
1-N-[4-[(benzylsulfonylamino)-butylamino]-3-hydroxy-1-(4-hydroxyphenyl)butan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide (PubChem CID 23398655) has the molecular formula C36H49N5O7S and a molecular weight of 695.88 g/mol. Its IUPAC name is 1-N-[4-[(benzylsulfonylamino)-butylamino]-3-hydroxy-1-(4-hydroxyphenyl)butan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide.
| Compound Name | 1-N-[4-[(benzylsulfonylamino)-butylamino]-3-hydroxy-1-(4-hydroxyphenyl)butan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 23398655 |
| Molecular Formula | C36H49N5O7S |
| Molecular Weight | 695.88 g/mol |
| Exact Mass | 695.34 |
| IUPAC Name | 1-N-[4-[(benzylsulfonylamino)-butylamino]-3-hydroxy-1-(4-hydroxyphenyl)butan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
| SMILES | CCCCN(CC(O)C(Cc1ccc(O)cc1)NC(=O)c1cc(C(N)=O)cc(C(=O)N(CCC)CCC)c1)NS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C36H49N5O7S/c1-4-7-19-41(39-49(47,48)25-27-11-9-8-10-12-27)24-33(43)32(20-26-13-15-31(42)16-14-26)38-35(45)29-21-28(34(37)44)22-30(23-29)36(46)40(17-5-2)18-6-3/h8-16,21-23,32-33,39,42-43H,4-7,17-20,24-25H2,1-3H3,(H2,37,44)(H,38,45) |
| InChIKey | NTRBNNKODIEHEU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 182.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.88 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|