C35H44N4O5S — CID 23398889
1-N-[4-[benzenesulfonamido(propyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-5-ethynyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 23398889) has the molecular formula C35H44N4O5S and a molecular weight of 632.83 g/mol. Its IUPAC name is 1-N-[4-[benzenesulfonamido(propyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-5-ethynyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[4-[benzenesulfonamido(propyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-5-ethynyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 23398889 |
| Molecular Formula | C35H44N4O5S |
| Molecular Weight | 632.83 g/mol |
| Exact Mass | 632.30 |
| IUPAC Name | 1-N-[4-[benzenesulfonamido(propyl)amino]-3-hydroxy-1-phenylbutan-2-yl]-5-ethynyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | C#Cc1cc(C(=O)NC(Cc2ccccc2)C(O)CN(CCC)NS(=O)(=O)c2ccccc2)cc(C(=O)N(CCC)CCC)c1 |
| InChI | InChI=1S/C35H44N4O5S/c1-5-19-38(20-6-2)35(42)30-23-27(8-4)22-29(25-30)34(41)36-32(24-28-15-11-9-12-16-28)33(40)26-39(21-7-3)37-45(43,44)31-17-13-10-14-18-31/h4,9-18,22-23,25,32-33,37,40H,5-7,19-21,24,26H2,1-3H3,(H,36,41) |
| InChIKey | LMWISVGTMCXSRJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.83 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|