C38H46F2N4O4 — CID 10146359
1-N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[(2-phenylacetyl)amino]-propylamino]butan-2-yl]-3-N,3-N-dipropyl-5-prop-1-ynylbenzene-1,3-dicarboxamide (PubChem CID 10146359) has the molecular formula C38H46F2N4O4 and a molecular weight of 660.81 g/mol. Its IUPAC name is 1-N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[(2-phenylacetyl)amino]-propylamino]butan-2-yl]-3-N,3-N-dipropyl-5-prop-1-ynylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[(2-phenylacetyl)amino]-propylamino]butan-2-yl]-3-N,3-N-dipropyl-5-prop-1-ynylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 10146359 |
| Molecular Formula | C38H46F2N4O4 |
| Molecular Weight | 660.81 g/mol |
| Exact Mass | 660.35 |
| IUPAC Name | 1-N-[1-(3,5-difluorophenyl)-3-hydroxy-4-[[(2-phenylacetyl)amino]-propylamino]butan-2-yl]-3-N,3-N-dipropyl-5-prop-1-ynylbenzene-1,3-dicarboxamide |
| SMILES | CC#Cc1cc(C(=O)NC(Cc2cc(F)cc(F)c2)C(O)CN(CCC)NC(=O)Cc2ccccc2)cc(C(=O)N(CCC)CCC)c1 |
| InChI | InChI=1S/C38H46F2N4O4/c1-5-12-28-18-30(24-31(19-28)38(48)43(15-6-2)16-7-3)37(47)41-34(22-29-20-32(39)25-33(40)21-29)35(45)26-44(17-8-4)42-36(46)23-27-13-10-9-11-14-27/h9-11,13-14,18-21,24-25,34-35,45H,6-8,15-17,22-23,26H2,1-4H3,(H,41,47)(H,42,46) |
| InChIKey | LZTQCEDNSRXEOU-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.81 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|