C31H44N4O5S — CID 23398685
1-N-[3-hydroxy-4-[methyl-(propan-2-ylsulfonylamino)amino]-1-phenylbutan-2-yl]-3-N,3-N-dipropyl-5-prop-1-ynylbenzene-1,3-dicarboxamide (PubChem CID 23398685) has the molecular formula C31H44N4O5S and a molecular weight of 584.78 g/mol. Its IUPAC name is 1-N-[3-hydroxy-4-[methyl-(propan-2-ylsulfonylamino)amino]-1-phenylbutan-2-yl]-3-N,3-N-dipropyl-5-prop-1-ynylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[3-hydroxy-4-[methyl-(propan-2-ylsulfonylamino)amino]-1-phenylbutan-2-yl]-3-N,3-N-dipropyl-5-prop-1-ynylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 23398685 |
| Molecular Formula | C31H44N4O5S |
| Molecular Weight | 584.78 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | 1-N-[3-hydroxy-4-[methyl-(propan-2-ylsulfonylamino)amino]-1-phenylbutan-2-yl]-3-N,3-N-dipropyl-5-prop-1-ynylbenzene-1,3-dicarboxamide |
| SMILES | CC#Cc1cc(C(=O)NC(Cc2ccccc2)C(O)CN(C)NS(=O)(=O)C(C)C)cc(C(=O)N(CCC)CCC)c1 |
| InChI | InChI=1S/C31H44N4O5S/c1-7-13-25-18-26(21-27(19-25)31(38)35(16-8-2)17-9-3)30(37)32-28(20-24-14-11-10-12-15-24)29(36)22-34(6)33-41(39,40)23(4)5/h10-12,14-15,18-19,21,23,28-29,33,36H,8-9,16-17,20,22H2,1-6H3,(H,32,37) |
| InChIKey | GVLRPWFXNOXYJV-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.78 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|