C33H38F2N4O5S — CID 23398873
1-N-[4-[benzenesulfonamido(methyl)amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-ethynyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 23398873) has the molecular formula C33H38F2N4O5S and a molecular weight of 640.75 g/mol. Its IUPAC name is 1-N-[4-[benzenesulfonamido(methyl)amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-ethynyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[4-[benzenesulfonamido(methyl)amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-ethynyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 23398873 |
| Molecular Formula | C33H38F2N4O5S |
| Molecular Weight | 640.75 g/mol |
| Exact Mass | 640.25 |
| IUPAC Name | 1-N-[4-[benzenesulfonamido(methyl)amino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-ethynyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | C#Cc1cc(C(=O)NC(Cc2cc(F)cc(F)c2)C(O)CN(C)NS(=O)(=O)c2ccccc2)cc(C(=O)N(CCC)CCC)c1 |
| InChI | InChI=1S/C33H38F2N4O5S/c1-5-13-39(14-6-2)33(42)26-16-23(7-3)15-25(20-26)32(41)36-30(19-24-17-27(34)21-28(35)18-24)31(40)22-38(4)37-45(43,44)29-11-9-8-10-12-29/h3,8-12,15-18,20-21,30-31,37,40H,5-6,13-14,19,22H2,1-2,4H3,(H,36,41) |
| InChIKey | RICNZRDUXQNFCA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.75 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|