C34H50N4O5S — CID 23398711
1-N-[4-[butyl-(2-methylpropylsulfonylamino)amino]-3-hydroxy-1-phenylbutan-2-yl]-5-ethynyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 23398711) has the molecular formula C34H50N4O5S and a molecular weight of 626.86 g/mol. Its IUPAC name is 1-N-[4-[butyl-(2-methylpropylsulfonylamino)amino]-3-hydroxy-1-phenylbutan-2-yl]-5-ethynyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[4-[butyl-(2-methylpropylsulfonylamino)amino]-3-hydroxy-1-phenylbutan-2-yl]-5-ethynyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 23398711 |
| Molecular Formula | C34H50N4O5S |
| Molecular Weight | 626.86 g/mol |
| Exact Mass | 626.35 |
| IUPAC Name | 1-N-[4-[butyl-(2-methylpropylsulfonylamino)amino]-3-hydroxy-1-phenylbutan-2-yl]-5-ethynyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | C#Cc1cc(C(=O)NC(Cc2ccccc2)C(O)CN(CCCC)NS(=O)(=O)CC(C)C)cc(C(=O)N(CCC)CCC)c1 |
| InChI | InChI=1S/C34H50N4O5S/c1-7-11-19-38(36-44(42,43)25-26(5)6)24-32(39)31(22-28-15-13-12-14-16-28)35-33(40)29-20-27(10-4)21-30(23-29)34(41)37(17-8-2)18-9-3/h4,12-16,20-21,23,26,31-32,36,39H,7-9,11,17-19,22,24-25H2,1-3,5-6H3,(H,35,40) |
| InChIKey | WLNDUFSZWRBHNR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.86 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|