C34H45N5O6S — CID 23398761
1-N-[4-[(benzylsulfonylamino)-ethylamino]-3-hydroxy-1-phenylbutan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide (PubChem CID 23398761) has the molecular formula C34H45N5O6S and a molecular weight of 651.83 g/mol. Its IUPAC name is 1-N-[4-[(benzylsulfonylamino)-ethylamino]-3-hydroxy-1-phenylbutan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide.
| Compound Name | 1-N-[4-[(benzylsulfonylamino)-ethylamino]-3-hydroxy-1-phenylbutan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 23398761 |
| Molecular Formula | C34H45N5O6S |
| Molecular Weight | 651.83 g/mol |
| Exact Mass | 651.31 |
| IUPAC Name | 1-N-[4-[(benzylsulfonylamino)-ethylamino]-3-hydroxy-1-phenylbutan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C(N)=O)cc(C(=O)NC(Cc2ccccc2)C(O)CN(CC)NS(=O)(=O)Cc2ccccc2)c1 |
| InChI | InChI=1S/C34H45N5O6S/c1-4-17-38(18-5-2)34(43)29-21-27(32(35)41)20-28(22-29)33(42)36-30(19-25-13-9-7-10-14-25)31(40)23-39(6-3)37-46(44,45)24-26-15-11-8-12-16-26/h7-16,20-22,30-31,37,40H,4-6,17-19,23-24H2,1-3H3,(H2,35,41)(H,36,42) |
| InChIKey | XTHKAPCGGFSTDO-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 162.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.83 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|