C33H46F2N4O5S — CID 23398636
1-N-[1-(3,5-difluorophenyl)-4-[ethyl-(2-methylpropylsulfonylamino)amino]-3-hydroxybutan-2-yl]-3-N,3-N-dipropyl-5-prop-1-ynylbenzene-1,3-dicarboxamide (PubChem CID 23398636) has the molecular formula C33H46F2N4O5S and a molecular weight of 648.82 g/mol. Its IUPAC name is 1-N-[1-(3,5-difluorophenyl)-4-[ethyl-(2-methylpropylsulfonylamino)amino]-3-hydroxybutan-2-yl]-3-N,3-N-dipropyl-5-prop-1-ynylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[1-(3,5-difluorophenyl)-4-[ethyl-(2-methylpropylsulfonylamino)amino]-3-hydroxybutan-2-yl]-3-N,3-N-dipropyl-5-prop-1-ynylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 23398636 |
| Molecular Formula | C33H46F2N4O5S |
| Molecular Weight | 648.82 g/mol |
| Exact Mass | 648.32 |
| IUPAC Name | 1-N-[1-(3,5-difluorophenyl)-4-[ethyl-(2-methylpropylsulfonylamino)amino]-3-hydroxybutan-2-yl]-3-N,3-N-dipropyl-5-prop-1-ynylbenzene-1,3-dicarboxamide |
| SMILES | CC#Cc1cc(C(=O)NC(Cc2cc(F)cc(F)c2)C(O)CN(CC)NS(=O)(=O)CC(C)C)cc(C(=O)N(CCC)CCC)c1 |
| InChI | InChI=1S/C33H46F2N4O5S/c1-7-11-24-14-26(19-27(15-24)33(42)38(12-8-2)13-9-3)32(41)36-30(18-25-16-28(34)20-29(35)17-25)31(40)21-39(10-4)37-45(43,44)22-23(5)6/h14-17,19-20,23,30-31,37,40H,8-10,12-13,18,21-22H2,1-6H3,(H,36,41) |
| InChIKey | CTYSEJVHKWSTAE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 119.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.82 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|