C34H50N4O6S — CID 23398738
1-N-[3-hydroxy-1-(4-hydroxyphenyl)-4-[(2-methylpropylsulfonylamino)-propylamino]butan-2-yl]-3-N,3-N-dipropyl-5-prop-1-ynylbenzene-1,3-dicarboxamide (PubChem CID 23398738) has the molecular formula C34H50N4O6S and a molecular weight of 642.86 g/mol. Its IUPAC name is 1-N-[3-hydroxy-1-(4-hydroxyphenyl)-4-[(2-methylpropylsulfonylamino)-propylamino]butan-2-yl]-3-N,3-N-dipropyl-5-prop-1-ynylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[3-hydroxy-1-(4-hydroxyphenyl)-4-[(2-methylpropylsulfonylamino)-propylamino]butan-2-yl]-3-N,3-N-dipropyl-5-prop-1-ynylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 23398738 |
| Molecular Formula | C34H50N4O6S |
| Molecular Weight | 642.86 g/mol |
| Exact Mass | 642.35 |
| IUPAC Name | 1-N-[3-hydroxy-1-(4-hydroxyphenyl)-4-[(2-methylpropylsulfonylamino)-propylamino]butan-2-yl]-3-N,3-N-dipropyl-5-prop-1-ynylbenzene-1,3-dicarboxamide |
| SMILES | CC#Cc1cc(C(=O)NC(Cc2ccc(O)cc2)C(O)CN(CCC)NS(=O)(=O)CC(C)C)cc(C(=O)N(CCC)CCC)c1 |
| InChI | InChI=1S/C34H50N4O6S/c1-7-11-27-19-28(22-29(20-27)34(42)37(16-8-2)17-9-3)33(41)35-31(21-26-12-14-30(39)15-13-26)32(40)23-38(18-10-4)36-45(43,44)24-25(5)6/h12-15,19-20,22,25,31-32,36,39-40H,8-10,16-18,21,23-24H2,1-6H3,(H,35,41) |
| InChIKey | XQFDHLDMNSBIDL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.86 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|