C32H44N4O5 — CID 23398591
5-ethynyl-1-N-[3-hydroxy-1-(4-hydroxyphenyl)-4-[methyl-(3-methylbutanoylamino)amino]butan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 23398591) has the molecular formula C32H44N4O5 and a molecular weight of 564.73 g/mol. Its IUPAC name is 5-ethynyl-1-N-[3-hydroxy-1-(4-hydroxyphenyl)-4-[methyl-(3-methylbutanoylamino)amino]butan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 5-ethynyl-1-N-[3-hydroxy-1-(4-hydroxyphenyl)-4-[methyl-(3-methylbutanoylamino)amino]butan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 23398591 |
| Molecular Formula | C32H44N4O5 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.33 |
| IUPAC Name | 5-ethynyl-1-N-[3-hydroxy-1-(4-hydroxyphenyl)-4-[methyl-(3-methylbutanoylamino)amino]butan-2-yl]-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | C#Cc1cc(C(=O)NC(Cc2ccc(O)cc2)C(O)CN(C)NC(=O)CC(C)C)cc(C(=O)N(CCC)CCC)c1 |
| InChI | InChI=1S/C32H44N4O5/c1-7-14-36(15-8-2)32(41)26-18-23(9-3)17-25(20-26)31(40)33-28(19-24-10-12-27(37)13-11-24)29(38)21-35(6)34-30(39)16-22(4)5/h3,10-13,17-18,20,22,28-29,37-38H,7-8,14-16,19,21H2,1-2,4-6H3,(H,33,40)(H,34,39) |
| InChIKey | RCUZTFUHJGLMDV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|