C37H46F2N4O6 — CID 23577953
1-N-[5-(benzylcarbamoyl)-1-(3,5-difluorophenyl)-3,4-dihydroxy-6-methylheptan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide (PubChem CID 23577953) has the molecular formula C37H46F2N4O6 and a molecular weight of 680.79 g/mol. Its IUPAC name is 1-N-[5-(benzylcarbamoyl)-1-(3,5-difluorophenyl)-3,4-dihydroxy-6-methylheptan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide.
| Compound Name | 1-N-[5-(benzylcarbamoyl)-1-(3,5-difluorophenyl)-3,4-dihydroxy-6-methylheptan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 23577953 |
| Molecular Formula | C37H46F2N4O6 |
| Molecular Weight | 680.79 g/mol |
| Exact Mass | 680.34 |
| IUPAC Name | 1-N-[5-(benzylcarbamoyl)-1-(3,5-difluorophenyl)-3,4-dihydroxy-6-methylheptan-2-yl]-3-N,3-N-dipropylbenzene-1,3,5-tricarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C(N)=O)cc(C(=O)NC(Cc2cc(F)cc(F)c2)C(O)C(O)C(C(=O)NCc2ccccc2)C(C)C)c1 |
| InChI | InChI=1S/C37H46F2N4O6/c1-5-12-43(13-6-2)37(49)27-18-25(34(40)46)17-26(19-27)35(47)42-30(16-24-14-28(38)20-29(39)15-24)32(44)33(45)31(22(3)4)36(48)41-21-23-10-8-7-9-11-23/h7-11,14-15,17-20,22,30-33,44-45H,5-6,12-13,16,21H2,1-4H3,(H2,40,46)(H,41,48)(H,42,47) |
| InChIKey | VWVYUACXFPFOOX-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 162.06 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.79 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |