C31H41F2N3O3 — CID 87823636
1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-(hex-5-ynylamino)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 87823636) has the molecular formula C31H41F2N3O3 and a molecular weight of 541.68 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-(hex-5-ynylamino)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-(hex-5-ynylamino)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 87823636 |
| Molecular Formula | C31H41F2N3O3 |
| Molecular Weight | 541.68 g/mol |
| Exact Mass | 541.31 |
| IUPAC Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-(hex-5-ynylamino)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | C#CCCCCNC[C@@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)c1cc(C)cc(C(=O)N(CCC)CCC)c1 |
| InChI | InChI=1S/C31H41F2N3O3/c1-5-8-9-10-11-34-21-29(37)28(18-23-16-26(32)20-27(33)17-23)35-30(38)24-14-22(4)15-25(19-24)31(39)36(12-6-2)13-7-3/h1,14-17,19-20,28-29,34,37H,6-13,18,21H2,2-4H3,(H,35,38)/t28-,29+/m0/s1 |
| InChIKey | ZCMWLAKAJHLWLZ-URLMMPGGSA-N |
| XLogP | 4.63 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.68 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|