C36H48F2N4O3 — CID 68832438
1-N-[(2S,3R)-4-[[3-(diethylamino)phenyl]methylamino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 68832438) has the molecular formula C36H48F2N4O3 and a molecular weight of 622.80 g/mol. Its IUPAC name is 1-N-[(2S,3R)-4-[[3-(diethylamino)phenyl]methylamino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-4-[[3-(diethylamino)phenyl]methylamino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 68832438 |
| Molecular Formula | C36H48F2N4O3 |
| Molecular Weight | 622.80 g/mol |
| Exact Mass | 622.37 |
| IUPAC Name | 1-N-[(2S,3R)-4-[[3-(diethylamino)phenyl]methylamino]-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CNCc2cccc(N(CC)CC)c2)c1 |
| InChI | InChI=1S/C36H48F2N4O3/c1-6-13-42(14-7-2)36(45)29-16-25(5)15-28(21-29)35(44)40-33(20-27-17-30(37)22-31(38)18-27)34(43)24-39-23-26-11-10-12-32(19-26)41(8-3)9-4/h10-12,15-19,21-22,33-34,39,43H,6-9,13-14,20,23-24H2,1-5H3,(H,40,44)/t33-,34+/m0/s1 |
| InChIKey | YMJRAPOATLZHIN-SZAHLOSFSA-N |
| XLogP | 5.87 |
| TPSA | 84.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.80 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |