C35H45F2N3O4 — CID 69413509
1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-propan-2-yloxyphenyl)methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 69413509) has the molecular formula C35H45F2N3O4 and a molecular weight of 609.76 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-propan-2-yloxyphenyl)methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-propan-2-yloxyphenyl)methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 69413509 |
| Molecular Formula | C35H45F2N3O4 |
| Molecular Weight | 609.76 g/mol |
| Exact Mass | 609.34 |
| IUPAC Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(3-propan-2-yloxyphenyl)methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CNCc2cccc(OC(C)C)c2)c1 |
| InChI | InChI=1S/C35H45F2N3O4/c1-6-11-40(12-7-2)35(43)28-14-24(5)13-27(19-28)34(42)39-32(18-26-15-29(36)20-30(37)16-26)33(41)22-38-21-25-9-8-10-31(17-25)44-23(3)4/h8-10,13-17,19-20,23,32-33,38,41H,6-7,11-12,18,21-22H2,1-5H3,(H,39,42)/t32-,33+/m0/s1 |
| InChIKey | HWTCUZCGKQJBDX-JHOUSYSJSA-N |
| XLogP | 5.81 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.76 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |