C33H42F2N4O3 — CID 58802768
1-N-[(2R,3S)-1-(3,5-difluorophenyl)-4-[(4-ethyl-2-pyridinyl)methylamino]-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 58802768) has the molecular formula C33H42F2N4O3 and a molecular weight of 580.72 g/mol. Its IUPAC name is 1-N-[(2R,3S)-1-(3,5-difluorophenyl)-4-[(4-ethyl-2-pyridinyl)methylamino]-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2R,3S)-1-(3,5-difluorophenyl)-4-[(4-ethyl-2-pyridinyl)methylamino]-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 58802768 |
| Molecular Formula | C33H42F2N4O3 |
| Molecular Weight | 580.72 g/mol |
| Exact Mass | 580.32 |
| IUPAC Name | 1-N-[(2R,3S)-1-(3,5-difluorophenyl)-4-[(4-ethyl-2-pyridinyl)methylamino]-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)N[C@H](Cc2cc(F)cc(F)c2)[C@@H](O)CNCc2cc(CC)ccn2)c1 |
| InChI | InChI=1S/C33H42F2N4O3/c1-5-10-39(11-6-2)33(42)26-13-22(4)12-25(18-26)32(41)38-30(17-24-14-27(34)19-28(35)15-24)31(40)21-36-20-29-16-23(7-3)8-9-37-29/h8-9,12-16,18-19,30-31,36,40H,5-7,10-11,17,20-21H2,1-4H3,(H,38,41)/t30-,31+/m1/s1 |
| InChIKey | KFXNXUGIPZKWBM-JSOSNVBQSA-N |
| XLogP | 4.98 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.72 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |