C33H43F2N5O3 — CID 68832793
1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(6-propan-2-ylpyrazin-2-yl)methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 68832793) has the molecular formula C33H43F2N5O3 and a molecular weight of 595.74 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(6-propan-2-ylpyrazin-2-yl)methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(6-propan-2-ylpyrazin-2-yl)methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 68832793 |
| Molecular Formula | C33H43F2N5O3 |
| Molecular Weight | 595.74 g/mol |
| Exact Mass | 595.33 |
| IUPAC Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(6-propan-2-ylpyrazin-2-yl)methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CNCc2cncc(C(C)C)n2)c1 |
| InChI | InChI=1S/C33H43F2N5O3/c1-6-8-40(9-7-2)33(43)25-11-22(5)10-24(15-25)32(42)39-29(14-23-12-26(34)16-27(35)13-23)31(41)20-37-18-28-17-36-19-30(38-28)21(3)4/h10-13,15-17,19,21,29,31,37,41H,6-9,14,18,20H2,1-5H3,(H,39,42)/t29-,31+/m0/s1 |
| InChIKey | LTNTXUHKUCKBDD-IGYGKHONSA-N |
| XLogP | 4.94 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.74 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |