C30H38F2N4O3S — CID 21085225
1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(2-methyl-1,3-thiazol-5-yl)methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 21085225) has the molecular formula C30H38F2N4O3S and a molecular weight of 572.72 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(2-methyl-1,3-thiazol-5-yl)methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(2-methyl-1,3-thiazol-5-yl)methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 21085225 |
| Molecular Formula | C30H38F2N4O3S |
| Molecular Weight | 572.72 g/mol |
| Exact Mass | 572.26 |
| IUPAC Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[(2-methyl-1,3-thiazol-5-yl)methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CNCc2cnc(C)s2)c1 |
| InChI | InChI=1S/C30H38F2N4O3S/c1-5-7-36(8-6-2)30(39)23-10-19(3)9-22(14-23)29(38)35-27(13-21-11-24(31)15-25(32)12-21)28(37)18-33-16-26-17-34-20(4)40-26/h9-12,14-15,17,27-28,33,37H,5-8,13,16,18H2,1-4H3,(H,35,38)/t27-,28+/m0/s1 |
| InChIKey | IQBDCILRVAFVOW-WUFINQPMSA-N |
| XLogP | 4.79 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.72 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |