C32H43F2N5O3S — CID 69414399
1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 69414399) has the molecular formula C32H43F2N5O3S and a molecular weight of 615.79 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 69414399 |
| Molecular Formula | C32H43F2N5O3S |
| Molecular Weight | 615.79 g/mol |
| Exact Mass | 615.31 |
| IUPAC Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-3-hydroxy-4-[[5-(2-methylpropyl)-1,3,4-thiadiazol-2-yl]methylamino]butan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CNCc2nnc(CC(C)C)s2)c1 |
| InChI | InChI=1S/C32H43F2N5O3S/c1-6-8-39(9-7-2)32(42)24-12-21(5)11-23(16-24)31(41)36-27(15-22-13-25(33)17-26(34)14-22)28(40)18-35-19-30-38-37-29(43-30)10-20(3)4/h11-14,16-17,20,27-28,35,40H,6-10,15,18-19H2,1-5H3,(H,36,41)/t27-,28+/m0/s1 |
| InChIKey | RZUGRLQVVKHXMY-WUFINQPMSA-N |
| XLogP | 5.08 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.79 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |