C40H59F2N3O3 — CID 68607343
1-N-[(2S,3R)-4-(1,3-dicyclohexylpropylamino)-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 68607343) has the molecular formula C40H59F2N3O3 and a molecular weight of 667.93 g/mol. Its IUPAC name is 1-N-[(2S,3R)-4-(1,3-dicyclohexylpropylamino)-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-4-(1,3-dicyclohexylpropylamino)-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 68607343 |
| Molecular Formula | C40H59F2N3O3 |
| Molecular Weight | 667.93 g/mol |
| Exact Mass | 667.45 |
| IUPAC Name | 1-N-[(2S,3R)-4-(1,3-dicyclohexylpropylamino)-1-(3,5-difluorophenyl)-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CNC(CCC2CCCCC2)C2CCCCC2)c1 |
| InChI | InChI=1S/C40H59F2N3O3/c1-4-18-45(19-5-2)40(48)33-21-28(3)20-32(25-33)39(47)44-37(24-30-22-34(41)26-35(42)23-30)38(46)27-43-36(31-14-10-7-11-15-31)17-16-29-12-8-6-9-13-29/h20-23,25-26,29,31,36-38,43,46H,4-19,24,27H2,1-3H3,(H,44,47)/t36?,37-,38+/m0/s1 |
| InChIKey | JYJIJIJIXOMVBE-GGJINPDOSA-N |
| XLogP | 8.14 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.93 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |