C33H47F2N3O3 — CID 68610318
1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(2,3-dimethylcyclohexyl)amino]-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 68610318) has the molecular formula C33H47F2N3O3 and a molecular weight of 571.75 g/mol. Its IUPAC name is 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(2,3-dimethylcyclohexyl)amino]-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(2,3-dimethylcyclohexyl)amino]-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 68610318 |
| Molecular Formula | C33H47F2N3O3 |
| Molecular Weight | 571.75 g/mol |
| Exact Mass | 571.36 |
| IUPAC Name | 1-N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(2,3-dimethylcyclohexyl)amino]-3-hydroxybutan-2-yl]-5-methyl-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cc(C)cc(C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)CNC2CCCC(C)C2C)c1 |
| InChI | InChI=1S/C33H47F2N3O3/c1-6-11-38(12-7-2)33(41)26-14-21(3)13-25(18-26)32(40)37-30(17-24-15-27(34)19-28(35)16-24)31(39)20-36-29-10-8-9-22(4)23(29)5/h13-16,18-19,22-23,29-31,36,39H,6-12,17,20H2,1-5H3,(H,37,40)/t22?,23?,29?,30-,31+/m0/s1 |
| InChIKey | TVDBDSNXNBHDLK-CHFJRHSESA-N |
| XLogP | 5.65 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.75 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |