C11H13NO4S — CID 134968902
(1R)-1-[(4R)-2,2-dioxo-3,4-dihydro-1,2λ6,3-benzoxathiazin-4-yl]but-3-en-1-ol (PubChem CID 134968902) has the molecular formula C11H13NO4S and a molecular weight of 255.29 g/mol. Its IUPAC name is (1R)-1-[(4R)-2,2-dioxo-3,4-dihydro-1,2λ6,3-benzoxathiazin-4-yl]but-3-en-1-ol.
| Compound Name | (1R)-1-[(4R)-2,2-dioxo-3,4-dihydro-1,2λ6,3-benzoxathiazin-4-yl]but-3-en-1-ol |
|---|---|
| PubChem CID | 134968902 |
| Molecular Formula | C11H13NO4S |
| Molecular Weight | 255.29 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | (1R)-1-[(4R)-2,2-dioxo-3,4-dihydro-1,2λ6,3-benzoxathiazin-4-yl]but-3-en-1-ol |
| SMILES | C=CC[C@@H](O)[C@@H]1NS(=O)(=O)Oc2ccccc21 |
| InChI | InChI=1S/C11H13NO4S/c1-2-5-9(13)11-8-6-3-4-7-10(8)16-17(14,15)12-11/h2-4,6-7,9,11-13H,1,5H2/t9-,11-/m1/s1 |
| InChIKey | LINDFKUHFGVCHT-MWLCHTKSSA-N |
| XLogP | 0.89 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|