C27H26BrNO3S — CID 134961577
(4S)-6-bromo-4-[(3R,4E)-2-methyl-5,7-diphenylhepta-1,4-dien-3-yl]-3,4-dihydro-1,2λ6,3-benzoxathiazine 2,2-dioxide (PubChem CID 134961577) has the molecular formula C27H26BrNO3S and a molecular weight of 524.48 g/mol. Its IUPAC name is (4S)-6-bromo-4-[(3R,4E)-2-methyl-5,7-diphenylhepta-1,4-dien-3-yl]-3,4-dihydro-1,2λ6,3-benzoxathiazine 2,2-dioxide.
| Compound Name | (4S)-6-bromo-4-[(3R,4E)-2-methyl-5,7-diphenylhepta-1,4-dien-3-yl]-3,4-dihydro-1,2λ6,3-benzoxathiazine 2,2-dioxide |
|---|---|
| PubChem CID | 134961577 |
| Molecular Formula | C27H26BrNO3S |
| Molecular Weight | 524.48 g/mol |
| Exact Mass | 523.08 |
| IUPAC Name | (4S)-6-bromo-4-[(3R,4E)-2-methyl-5,7-diphenylhepta-1,4-dien-3-yl]-3,4-dihydro-1,2λ6,3-benzoxathiazine 2,2-dioxide |
| SMILES | C=C(C)[C@@H](/C=C(\CCc1ccccc1)c1ccccc1)[C@@H]1NS(=O)(=O)Oc2ccc(Br)cc21 |
| InChI | InChI=1S/C27H26BrNO3S/c1-19(2)24(27-25-18-23(28)15-16-26(25)32-33(30,31)29-27)17-22(21-11-7-4-8-12-21)14-13-20-9-5-3-6-10-20/h3-12,15-18,24,27,29H,1,13-14H2,2H3/b22-17+/t24-,27+/m1/s1 |
| InChIKey | NFTGQWUCRYIYKO-RNAUIOIBSA-N |
| XLogP | 6.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.48 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|