C14H20BrNO3SSi — CID 162404281
2-[[(4S)-7-bromo-2,2-dioxo-3,4-dihydro-1,2λ6,3-benzoxathiazin-4-yl]methyl]prop-2-enyl-trimethylsilane (PubChem CID 162404281) has the molecular formula C14H20BrNO3SSi and a molecular weight of 390.38 g/mol. Its IUPAC name is 2-[[(4S)-7-bromo-2,2-dioxo-3,4-dihydro-1,2λ6,3-benzoxathiazin-4-yl]methyl]prop-2-enyl-trimethylsilane.
| Compound Name | 2-[[(4S)-7-bromo-2,2-dioxo-3,4-dihydro-1,2λ6,3-benzoxathiazin-4-yl]methyl]prop-2-enyl-trimethylsilane |
|---|---|
| PubChem CID | 162404281 |
| Molecular Formula | C14H20BrNO3SSi |
| Molecular Weight | 390.38 g/mol |
| Exact Mass | 389.01 |
| IUPAC Name | 2-[[(4S)-7-bromo-2,2-dioxo-3,4-dihydro-1,2λ6,3-benzoxathiazin-4-yl]methyl]prop-2-enyl-trimethylsilane |
| SMILES | C=C(C[C@@H]1NS(=O)(=O)Oc2cc(Br)ccc21)C[Si](C)(C)C |
| InChI | InChI=1S/C14H20BrNO3SSi/c1-10(9-21(2,3)4)7-13-12-6-5-11(15)8-14(12)19-20(17,18)16-13/h5-6,8,13,16H,1,7,9H2,2-4H3/t13-/m0/s1 |
| InChIKey | KHOSKDGHZGZXRX-ZDUSSCGKSA-N |
| XLogP | 4.00 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.38 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|