C13H17BrO2 — CID 104949560
(4S)-7-bromo-2,2-diethyl-3,4-dihydrochromen-4-ol (PubChem CID 104949560) has the molecular formula C13H17BrO2 and a molecular weight of 285.18 g/mol. Its IUPAC name is (4S)-7-bromo-2,2-diethyl-3,4-dihydrochromen-4-ol.
| Compound Name | (4S)-7-bromo-2,2-diethyl-3,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 104949560 |
| Molecular Formula | C13H17BrO2 |
| Molecular Weight | 285.18 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | (4S)-7-bromo-2,2-diethyl-3,4-dihydrochromen-4-ol |
| SMILES | CCC1(CC)C[C@H](O)c2ccc(Br)cc2O1 |
| InChI | InChI=1S/C13H17BrO2/c1-3-13(4-2)8-11(15)10-6-5-9(14)7-12(10)16-13/h5-7,11,15H,3-4,8H2,1-2H3/t11-/m0/s1 |
| InChIKey | YQVHMMXOKFCCRB-NSHDSACASA-N |
| XLogP | 3.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.18 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |