About 7-bromo-3'-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol
7-bromo-3'-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol (PubChem CID 114714735) has the molecular formula C14H17BrO2
and a molecular weight of 297.19 g/mol. Its IUPAC name is 7-bromo-3'-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol.
Molecular Properties
| Compound Name | 7-bromo-3'-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol |
| PubChem CID | 114714735 |
| Molecular Formula | C14H17BrO2 |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 7-bromo-3'-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol |
| SMILES | CC1CCC2(C1)CC(O)c1ccc(Br)cc1O2 |
| InChI | InChI=1S/C14H17BrO2/c1-9-4-5-14(7-9)8-12(16)11-3-2-10(15)6-13(11)17-14/h2-3,6,9,12,16H,4-5,7-8H2,1H3 |
| InChIKey | JZVFHFAOSBAKKC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-bromo-3'-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-3'-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol?
The IUPAC name of 7-bromo-3'-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol (CID 114714735) is 7-bromo-3'-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol.
What is the SMILES notation for 7-bromo-3'-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol?
The canonical SMILES for 7-bromo-3'-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol is CC1CCC2(C1)CC(O)c1ccc(Br)cc1O2.
What is the InChIKey of 7-bromo-3'-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol?
The InChIKey is JZVFHFAOSBAKKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17BrO2/c1-9-4-5-14(7-9)8-12(16)11-3-2-10(15)6-13(11)17-14/h2-3,6,9,12,16H,4-5,7-8H2,1H3.
What are the key properties of 7-bromo-3'-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol?
7-bromo-3'-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol has a molecular weight of 297.19 g/mol, XLogP of 3.82, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-3'-methylspiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-ol is sourced from PubChem (CID 114714735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).