C16H21BrO3 — CID 104949352
(4R)-7-bromo-2'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-oxane]-4-ol (PubChem CID 104949352) has the molecular formula C16H21BrO3 and a molecular weight of 341.25 g/mol. Its IUPAC name is (4R)-7-bromo-2'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-oxane]-4-ol.
| Compound Name | (4R)-7-bromo-2'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-oxane]-4-ol |
|---|---|
| PubChem CID | 104949352 |
| Molecular Formula | C16H21BrO3 |
| Molecular Weight | 341.25 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | (4R)-7-bromo-2'-propan-2-ylspiro[3,4-dihydrochromene-2,4'-oxane]-4-ol |
| SMILES | CC(C)C1CC2(CCO1)C[C@@H](O)c1ccc(Br)cc1O2 |
| InChI | InChI=1S/C16H21BrO3/c1-10(2)15-9-16(5-6-19-15)8-13(18)12-4-3-11(17)7-14(12)20-16/h3-4,7,10,13,15,18H,5-6,8-9H2,1-2H3/t13-,15?,16?/m1/s1 |
| InChIKey | FBZZPMYHQKPPKA-IUDNXUCKSA-N |
| XLogP | 3.84 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.25 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |