C13H15NO2 — CID 10703988
(1R)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]but-3-en-1-ol (PubChem CID 10703988) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is (1R)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]but-3-en-1-ol.
| Compound Name | (1R)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]but-3-en-1-ol |
|---|---|
| PubChem CID | 10703988 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (1R)-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]but-3-en-1-ol |
| SMILES | C=CC[C@@H](O)[C@@H]1COC(c2ccccc2)=N1 |
| InChI | InChI=1S/C13H15NO2/c1-2-6-12(15)11-9-16-13(14-11)10-7-4-3-5-8-10/h2-5,7-8,11-12,15H,1,6,9H2/t11-,12+/m0/s1 |
| InChIKey | AZQLNHIRTUOUCX-NWDGAFQWSA-N |
| XLogP | 1.77 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|