C14H17NO5S — CID 10757407
[(1R,2R)-2-hydroxy-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]but-3-enyl] methanesulfonate (PubChem CID 10757407) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is [(1R,2R)-2-hydroxy-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]but-3-enyl] methanesulfonate.
| Compound Name | [(1R,2R)-2-hydroxy-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]but-3-enyl] methanesulfonate |
|---|---|
| PubChem CID | 10757407 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | [(1R,2R)-2-hydroxy-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]but-3-enyl] methanesulfonate |
| SMILES | C=C[C@@H](O)[C@H](OS(C)(=O)=O)[C@@H]1COC(c2ccccc2)=N1 |
| InChI | InChI=1S/C14H17NO5S/c1-3-12(16)13(20-21(2,17)18)11-9-19-14(15-11)10-7-5-4-6-8-10/h3-8,11-13,16H,1,9H2,2H3/t11-,12+,13+/m0/s1 |
| InChIKey | TYPAMLGWTLRXSD-YNEHKIRRSA-N |
| XLogP | 0.72 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|