C14H16INO5S — CID 10622819
[(R)-[(2R,3R)-3-(iodomethyl)oxiran-2-yl]-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methyl] methanesulfonate (PubChem CID 10622819) has the molecular formula C14H16INO5S and a molecular weight of 437.26 g/mol. Its IUPAC name is [(R)-[(2R,3R)-3-(iodomethyl)oxiran-2-yl]-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methyl] methanesulfonate.
| Compound Name | [(R)-[(2R,3R)-3-(iodomethyl)oxiran-2-yl]-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methyl] methanesulfonate |
|---|---|
| PubChem CID | 10622819 |
| Molecular Formula | C14H16INO5S |
| Molecular Weight | 437.26 g/mol |
| Exact Mass | 436.98 |
| IUPAC Name | [(R)-[(2R,3R)-3-(iodomethyl)oxiran-2-yl]-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]methyl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@@H]([C@@H]1O[C@H]1CI)[C@@H]1COC(c2ccccc2)=N1 |
| InChI | InChI=1S/C14H16INO5S/c1-22(17,18)21-12(13-11(7-15)20-13)10-8-19-14(16-10)9-5-3-2-4-6-9/h2-6,10-13H,7-8H2,1H3/t10-,11-,12+,13+/m0/s1 |
| InChIKey | IXWXBFLSDOSEOH-WUHRBBMRSA-N |
| XLogP | 1.38 |
| TPSA | 77.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.26 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|