C21H23NO6S — CID 10645623
[(1R)-3-(4-methylphenyl)sulfonyloxy-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]propyl] acetate (PubChem CID 10645623) has the molecular formula C21H23NO6S and a molecular weight of 417.48 g/mol. Its IUPAC name is [(1R)-3-(4-methylphenyl)sulfonyloxy-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]propyl] acetate.
| Compound Name | [(1R)-3-(4-methylphenyl)sulfonyloxy-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]propyl] acetate |
|---|---|
| PubChem CID | 10645623 |
| Molecular Formula | C21H23NO6S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | [(1R)-3-(4-methylphenyl)sulfonyloxy-1-[(4S)-2-phenyl-4,5-dihydro-1,3-oxazol-4-yl]propyl] acetate |
| SMILES | CC(=O)O[C@H](CCOS(=O)(=O)c1ccc(C)cc1)[C@@H]1COC(c2ccccc2)=N1 |
| InChI | InChI=1S/C21H23NO6S/c1-15-8-10-18(11-9-15)29(24,25)27-13-12-20(28-16(2)23)19-14-26-21(22-19)17-6-4-3-5-7-17/h3-11,19-20H,12-14H2,1-2H3/t19-,20+/m0/s1 |
| InChIKey | NWGMTGLZBWLBMR-VQTJNVASSA-N |
| XLogP | 2.87 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|