C18H16BrN3O6 — CID 135035301
(3'aS,8'bR)-7'-bromo-3'-ethenyl-1,3-dimethyl-3'a-nitrospiro[1,3-diazinane-5,1'-3,8b-dihydro-2H-cyclopenta[b][1]benzofuran]-2,4,6-trione (PubChem CID 135035301) has the molecular formula C18H16BrN3O6 and a molecular weight of 450.25 g/mol. Its IUPAC name is (3'aS,8'bR)-7'-bromo-3'-ethenyl-1,3-dimethyl-3'a-nitrospiro[1,3-diazinane-5,1'-3,8b-dihydro-2H-cyclopenta[b][1]benzofuran]-2,4,6-trione.
| Compound Name | (3'aS,8'bR)-7'-bromo-3'-ethenyl-1,3-dimethyl-3'a-nitrospiro[1,3-diazinane-5,1'-3,8b-dihydro-2H-cyclopenta[b][1]benzofuran]-2,4,6-trione |
|---|---|
| PubChem CID | 135035301 |
| Molecular Formula | C18H16BrN3O6 |
| Molecular Weight | 450.25 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | (3'aS,8'bR)-7'-bromo-3'-ethenyl-1,3-dimethyl-3'a-nitrospiro[1,3-diazinane-5,1'-3,8b-dihydro-2H-cyclopenta[b][1]benzofuran]-2,4,6-trione |
| SMILES | C=CC1CC2(C(=O)N(C)C(=O)N(C)C2=O)[C@H]2c3cc(Br)ccc3O[C@@]12[N+](=O)[O-] |
| InChI | InChI=1S/C18H16BrN3O6/c1-4-9-8-17(14(23)20(2)16(25)21(3)15(17)24)13-11-7-10(19)5-6-12(11)28-18(9,13)22(26)27/h4-7,9,13H,1,8H2,2-3H3/t9?,13-,18+/m1/s1 |
| InChIKey | UAPYOICHANTHFZ-GERTVRGJSA-N |
| XLogP | 2.14 |
| TPSA | 110.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|