C25H21BrClN3O3 — CID 177479041
(1S,9R,10R,11S)-4-bromo-11-(4-chlorophenyl)-10-nitro-9-phenyl-8-oxa-12,16-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2(7),3,5-triene (PubChem CID 177479041) has the molecular formula C25H21BrClN3O3 and a molecular weight of 526.82 g/mol. Its IUPAC name is (1S,9R,10R,11S)-4-bromo-11-(4-chlorophenyl)-10-nitro-9-phenyl-8-oxa-12,16-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2(7),3,5-triene.
| Compound Name | (1S,9R,10R,11S)-4-bromo-11-(4-chlorophenyl)-10-nitro-9-phenyl-8-oxa-12,16-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 177479041 |
| Molecular Formula | C25H21BrClN3O3 |
| Molecular Weight | 526.82 g/mol |
| Exact Mass | 525.05 |
| IUPAC Name | (1S,9R,10R,11S)-4-bromo-11-(4-chlorophenyl)-10-nitro-9-phenyl-8-oxa-12,16-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2(7),3,5-triene |
| SMILES | O=[N+]([O-])[C@@]12[C@@H](c3ccccc3)Oc3ccc(Br)cc3[C@@H]1N1CCCN1[C@H]2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H21BrClN3O3/c26-18-9-12-21-20(15-18)23-25(30(31)32,24(33-21)17-5-2-1-3-6-17)22(28-13-4-14-29(23)28)16-7-10-19(27)11-8-16/h1-3,5-12,15,22-24H,4,13-14H2/t22-,23-,24+,25+/m0/s1 |
| InChIKey | WSKNRTLYANMJDJ-CXSMSNRLSA-N |
| XLogP | 5.97 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.82 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|