C18H19N3O4 — CID 13127066
(3S,4R)-2,5-dimethyl-3a-nitro-3,4-diphenyl-4,6a-dihydro-3H-[1,2]oxazolo[4,5-d][1,2]oxazole (PubChem CID 13127066) has the molecular formula C18H19N3O4 and a molecular weight of 341.37 g/mol. Its IUPAC name is (3S,4R)-2,5-dimethyl-3a-nitro-3,4-diphenyl-4,6a-dihydro-3H-[1,2]oxazolo[4,5-d][1,2]oxazole.
| Compound Name | (3S,4R)-2,5-dimethyl-3a-nitro-3,4-diphenyl-4,6a-dihydro-3H-[1,2]oxazolo[4,5-d][1,2]oxazole |
|---|---|
| PubChem CID | 13127066 |
| Molecular Formula | C18H19N3O4 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | (3S,4R)-2,5-dimethyl-3a-nitro-3,4-diphenyl-4,6a-dihydro-3H-[1,2]oxazolo[4,5-d][1,2]oxazole |
| SMILES | CN1OC2ON(C)[C@H](c3ccccc3)C2([N+](=O)[O-])[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C18H19N3O4/c1-19-15(13-9-5-3-6-10-13)18(21(22)23)16(14-11-7-4-8-12-14)20(2)25-17(18)24-19/h3-12,15-17H,1-2H3/t15-,16+,17?,18? |
| InChIKey | MVGQVGNYBZTJHF-OQSMONGASA-N |
| XLogP | 2.56 |
| TPSA | 68.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|