C14H17NO3 — CID 102299695
(4S,5R)-2,2,4-trimethyl-3-methylidene-4-nitro-5-phenyloxolane (PubChem CID 102299695) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is (4S,5R)-2,2,4-trimethyl-3-methylidene-4-nitro-5-phenyloxolane.
| Compound Name | (4S,5R)-2,2,4-trimethyl-3-methylidene-4-nitro-5-phenyloxolane |
|---|---|
| PubChem CID | 102299695 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (4S,5R)-2,2,4-trimethyl-3-methylidene-4-nitro-5-phenyloxolane |
| SMILES | C=C1C(C)(C)O[C@H](c2ccccc2)[C@@]1(C)[N+](=O)[O-] |
| InChI | InChI=1S/C14H17NO3/c1-10-13(2,3)18-12(14(10,4)15(16)17)11-8-6-5-7-9-11/h5-9,12H,1H2,2-4H3/t12-,14+/m1/s1 |
| InChIKey | YNNHVDNSKPZQED-OCCSQVGLSA-N |
| XLogP | 3.13 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|