C13H15NO3 — CID 102329001
(2S,3R)-3,5-dimethyl-4-methylidene-3-nitro-2-phenyloxolane (PubChem CID 102329001) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is (2S,3R)-3,5-dimethyl-4-methylidene-3-nitro-2-phenyloxolane.
| Compound Name | (2S,3R)-3,5-dimethyl-4-methylidene-3-nitro-2-phenyloxolane |
|---|---|
| PubChem CID | 102329001 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | (2S,3R)-3,5-dimethyl-4-methylidene-3-nitro-2-phenyloxolane |
| SMILES | C=C1C(C)O[C@@H](c2ccccc2)[C@]1(C)[N+](=O)[O-] |
| InChI | InChI=1S/C13H15NO3/c1-9-10(2)17-12(13(9,3)14(15)16)11-7-5-4-6-8-11/h4-8,10,12H,1H2,2-3H3/t10?,12-,13+/m0/s1 |
| InChIKey | DAEPCUPUEJMNIE-HEVMSJOKSA-N |
| XLogP | 2.74 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|