C32H25BrN2O4S — CID 139203915
[(1S,2R,11S,12S,20S)-15-bromo-20-(4-methylphenyl)-1-nitro-19-oxa-3-thia-10-azapentacyclo[10.8.0.02,10.04,9.013,18]icosa-4,6,8,13(18),14,16-hexaen-11-yl]-(4-methylphenyl)methanone (PubChem CID 139203915) has the molecular formula C32H25BrN2O4S and a molecular weight of 613.53 g/mol. Its IUPAC name is [(1S,2R,11S,12S,20S)-15-bromo-20-(4-methylphenyl)-1-nitro-19-oxa-3-thia-10-azapentacyclo[10.8.0.02,10.04,9.013,18]icosa-4,6,8,13(18),14,16-hexaen-11-yl]-(4-methylphenyl)methanone.
| Compound Name | [(1S,2R,11S,12S,20S)-15-bromo-20-(4-methylphenyl)-1-nitro-19-oxa-3-thia-10-azapentacyclo[10.8.0.02,10.04,9.013,18]icosa-4,6,8,13(18),14,16-hexaen-11-yl]-(4-methylphenyl)methanone |
|---|---|
| PubChem CID | 139203915 |
| Molecular Formula | C32H25BrN2O4S |
| Molecular Weight | 613.53 g/mol |
| Exact Mass | 612.07 |
| IUPAC Name | [(1S,2R,11S,12S,20S)-15-bromo-20-(4-methylphenyl)-1-nitro-19-oxa-3-thia-10-azapentacyclo[10.8.0.02,10.04,9.013,18]icosa-4,6,8,13(18),14,16-hexaen-11-yl]-(4-methylphenyl)methanone |
| SMILES | Cc1ccc(C(=O)[C@@H]2[C@@H]3c4cc(Br)ccc4O[C@@H](c4ccc(C)cc4)[C@]3([N+](=O)[O-])[C@H]3Sc4ccccc4N23)cc1 |
| InChI | InChI=1S/C32H25BrN2O4S/c1-18-7-11-20(12-8-18)29(36)28-27-23-17-22(33)15-16-25(23)39-30(21-13-9-19(2)10-14-21)32(27,35(37)38)31-34(28)24-5-3-4-6-26(24)40-31/h3-17,27-28,30-31H,1-2H3/t27-,28-,30-,31+,32-/m0/s1 |
| InChIKey | ANADITRITXKFFO-GWUZOJNXSA-N |
| XLogP | 7.50 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.53 |
| LogP ≤ 5 | 7.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|