C17H14ClN3O3 — CID 10337523
(1R,3aS,4S,9bS)-4-(4-chlorophenyl)-1-methyl-3a-nitro-4,9b-dihydro-1H-chromeno[3,4-c]pyrazole (PubChem CID 10337523) has the molecular formula C17H14ClN3O3 and a molecular weight of 343.77 g/mol. Its IUPAC name is (1R,3aS,4S,9bS)-4-(4-chlorophenyl)-1-methyl-3a-nitro-4,9b-dihydro-1H-chromeno[3,4-c]pyrazole.
| Compound Name | (1R,3aS,4S,9bS)-4-(4-chlorophenyl)-1-methyl-3a-nitro-4,9b-dihydro-1H-chromeno[3,4-c]pyrazole |
|---|---|
| PubChem CID | 10337523 |
| Molecular Formula | C17H14ClN3O3 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | (1R,3aS,4S,9bS)-4-(4-chlorophenyl)-1-methyl-3a-nitro-4,9b-dihydro-1H-chromeno[3,4-c]pyrazole |
| SMILES | C[C@H]1N=N[C@@]2([N+](=O)[O-])[C@H](c3ccc(Cl)cc3)Oc3ccccc3[C@@H]12 |
| InChI | InChI=1S/C17H14ClN3O3/c1-10-15-13-4-2-3-5-14(13)24-16(11-6-8-12(18)9-7-11)17(15,20-19-10)21(22)23/h2-10,15-16H,1H3/t10-,15-,16+,17+/m1/s1 |
| InChIKey | AJICKDRSXOJQSI-XLUQRUARSA-N |
| XLogP | 4.38 |
| TPSA | 77.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|