C18H17N3O4 — CID 10315124
(1R,3aS,4S,9bS)-6-methoxy-1-methyl-3a-nitro-4-phenyl-4,9b-dihydro-1H-chromeno[3,4-c]pyrazole (PubChem CID 10315124) has the molecular formula C18H17N3O4 and a molecular weight of 339.35 g/mol. Its IUPAC name is (1R,3aS,4S,9bS)-6-methoxy-1-methyl-3a-nitro-4-phenyl-4,9b-dihydro-1H-chromeno[3,4-c]pyrazole.
| Compound Name | (1R,3aS,4S,9bS)-6-methoxy-1-methyl-3a-nitro-4-phenyl-4,9b-dihydro-1H-chromeno[3,4-c]pyrazole |
|---|---|
| PubChem CID | 10315124 |
| Molecular Formula | C18H17N3O4 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | (1R,3aS,4S,9bS)-6-methoxy-1-methyl-3a-nitro-4-phenyl-4,9b-dihydro-1H-chromeno[3,4-c]pyrazole |
| SMILES | COc1cccc2c1O[C@@H](c1ccccc1)[C@]1([N+](=O)[O-])N=N[C@H](C)[C@H]21 |
| InChI | InChI=1S/C18H17N3O4/c1-11-15-13-9-6-10-14(24-2)16(13)25-17(12-7-4-3-5-8-12)18(15,20-19-11)21(22)23/h3-11,15,17H,1-2H3/t11-,15-,17+,18+/m1/s1 |
| InChIKey | SHWLNZPEVLMTPG-CQIULORISA-N |
| XLogP | 3.74 |
| TPSA | 86.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|