C19H19N3O5 — CID 10361734
(1R,3aS,4S,9bS)-6-methoxy-4-(4-methoxyphenyl)-1-methyl-3a-nitro-4,9b-dihydro-1H-chromeno[3,4-c]pyrazole (PubChem CID 10361734) has the molecular formula C19H19N3O5 and a molecular weight of 369.38 g/mol. Its IUPAC name is (1R,3aS,4S,9bS)-6-methoxy-4-(4-methoxyphenyl)-1-methyl-3a-nitro-4,9b-dihydro-1H-chromeno[3,4-c]pyrazole.
| Compound Name | (1R,3aS,4S,9bS)-6-methoxy-4-(4-methoxyphenyl)-1-methyl-3a-nitro-4,9b-dihydro-1H-chromeno[3,4-c]pyrazole |
|---|---|
| PubChem CID | 10361734 |
| Molecular Formula | C19H19N3O5 |
| Molecular Weight | 369.38 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | (1R,3aS,4S,9bS)-6-methoxy-4-(4-methoxyphenyl)-1-methyl-3a-nitro-4,9b-dihydro-1H-chromeno[3,4-c]pyrazole |
| SMILES | COc1ccc([C@@H]2Oc3c(OC)cccc3[C@H]3[C@@H](C)N=N[C@@]23[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H19N3O5/c1-11-16-14-5-4-6-15(26-3)17(14)27-18(19(16,21-20-11)22(23)24)12-7-9-13(25-2)10-8-12/h4-11,16,18H,1-3H3/t11-,16-,18+,19+/m1/s1 |
| InChIKey | CQXLGWILUDRGBO-KSSRHRQWSA-N |
| XLogP | 3.75 |
| TPSA | 95.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.38 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|