C27H19Cl2N3O3 — CID 71503868
(6S,6aR,10aR)-7-amino-6,9-bis(4-chlorophenyl)-10-methyl-6a-nitro-6,10a-dihydrobenzo[c]chromene-8-carbonitrile (PubChem CID 71503868) has the molecular formula C27H19Cl2N3O3 and a molecular weight of 504.37 g/mol. Its IUPAC name is (6S,6aR,10aR)-7-amino-6,9-bis(4-chlorophenyl)-10-methyl-6a-nitro-6,10a-dihydrobenzo[c]chromene-8-carbonitrile.
| Compound Name | (6S,6aR,10aR)-7-amino-6,9-bis(4-chlorophenyl)-10-methyl-6a-nitro-6,10a-dihydrobenzo[c]chromene-8-carbonitrile |
|---|---|
| PubChem CID | 71503868 |
| Molecular Formula | C27H19Cl2N3O3 |
| Molecular Weight | 504.37 g/mol |
| Exact Mass | 503.08 |
| IUPAC Name | (6S,6aR,10aR)-7-amino-6,9-bis(4-chlorophenyl)-10-methyl-6a-nitro-6,10a-dihydrobenzo[c]chromene-8-carbonitrile |
| SMILES | CC1=C(c2ccc(Cl)cc2)C(C#N)=C(N)[C@]2([N+](=O)[O-])[C@H]1c1ccccc1O[C@H]2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H19Cl2N3O3/c1-15-23(16-6-10-18(28)11-7-16)21(14-30)25(31)27(32(33)34)24(15)20-4-2-3-5-22(20)35-26(27)17-8-12-19(29)13-9-17/h2-13,24,26H,31H2,1H3/t24-,26+,27-/m1/s1 |
| InChIKey | LZVOMSFPEUDVJU-FXVJXKIMSA-N |
| XLogP | 6.45 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.37 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|