C28H23N3O4 — CID 71505226
(6S,6aR,10aR)-7-imino-3-methoxy-10-methyl-6a-nitro-6,9-diphenyl-10,10a-dihydro-6H-benzo[c]chromene-8-carbonitrile (PubChem CID 71505226) has the molecular formula C28H23N3O4 and a molecular weight of 465.51 g/mol. Its IUPAC name is (6S,6aR,10aR)-7-imino-3-methoxy-10-methyl-6a-nitro-6,9-diphenyl-10,10a-dihydro-6H-benzo[c]chromene-8-carbonitrile.
| Compound Name | (6S,6aR,10aR)-7-imino-3-methoxy-10-methyl-6a-nitro-6,9-diphenyl-10,10a-dihydro-6H-benzo[c]chromene-8-carbonitrile |
|---|---|
| PubChem CID | 71505226 |
| Molecular Formula | C28H23N3O4 |
| Molecular Weight | 465.51 g/mol |
| Exact Mass | 465.17 |
| IUPAC Name | (6S,6aR,10aR)-7-imino-3-methoxy-10-methyl-6a-nitro-6,9-diphenyl-10,10a-dihydro-6H-benzo[c]chromene-8-carbonitrile |
| SMILES | [H]/N=C1\C(C#N)=C(c2ccccc2)C(C)[C@@H]2c3ccc(OC)cc3O[C@@H](c3ccccc3)[C@]12[N+](=O)[O-] |
| InChI | InChI=1S/C28H23N3O4/c1-17-24(18-9-5-3-6-10-18)22(16-29)26(30)28(31(32)33)25(17)21-14-13-20(34-2)15-23(21)35-27(28)19-11-7-4-8-12-19/h3-15,17,25,27,30H,1-2H3/b30-26+/t17?,25-,27+,28-/m1/s1 |
| InChIKey | KPYYWCNPVIQKQT-MCMYXEASSA-N |
| XLogP | 5.57 |
| TPSA | 109.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|