C18H18O5 — CID 163025438
(6R,6aR,11aS)-3,6,9-trimethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene (PubChem CID 163025438) has the molecular formula C18H18O5 and a molecular weight of 314.34 g/mol. Its IUPAC name is (6R,6aR,11aS)-3,6,9-trimethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene.
| Compound Name | (6R,6aR,11aS)-3,6,9-trimethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene |
|---|---|
| PubChem CID | 163025438 |
| Molecular Formula | C18H18O5 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | (6R,6aR,11aS)-3,6,9-trimethoxy-6a,11a-dihydro-6H-[1]benzofuro[3,2-c]chromene |
| SMILES | COc1ccc2c(c1)O[C@@H]1c3ccc(OC)cc3O[C@@H](OC)[C@H]21 |
| InChI | InChI=1S/C18H18O5/c1-19-10-4-6-12-14(8-10)22-17-13-7-5-11(20-2)9-15(13)23-18(21-3)16(12)17/h4-9,16-18H,1-3H3/t16-,17-,18-/m1/s1 |
| InChIKey | KGZXHPWOBPVKDK-KZNAEPCWSA-N |
| XLogP | 3.29 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |