C15H11Cl2NO4 — CID 46946639
(2S,3S,4S)-3-chloro-2-(2-chlorophenyl)-3-nitro-2,4-dihydrochromen-4-ol (PubChem CID 46946639) has the molecular formula C15H11Cl2NO4 and a molecular weight of 340.16 g/mol. Its IUPAC name is (2S,3S,4S)-3-chloro-2-(2-chlorophenyl)-3-nitro-2,4-dihydrochromen-4-ol.
| Compound Name | (2S,3S,4S)-3-chloro-2-(2-chlorophenyl)-3-nitro-2,4-dihydrochromen-4-ol |
|---|---|
| PubChem CID | 46946639 |
| Molecular Formula | C15H11Cl2NO4 |
| Molecular Weight | 340.16 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | (2S,3S,4S)-3-chloro-2-(2-chlorophenyl)-3-nitro-2,4-dihydrochromen-4-ol |
| SMILES | O=[N+]([O-])[C@]1(Cl)[C@@H](O)c2ccccc2O[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C15H11Cl2NO4/c16-11-7-3-1-5-9(11)14-15(17,18(20)21)13(19)10-6-2-4-8-12(10)22-14/h1-8,13-14,19H/t13-,14-,15+/m0/s1 |
| InChIKey | CYVVWESMFMSPIE-SOUVJXGZSA-N |
| XLogP | 3.72 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.16 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|