C17H15ClN2O4 — CID 124785457
(3aS,4R,9bS)-4-(4-chlorophenyl)-2-methyl-3a-nitro-4,9b-dihydro-1H-chromeno[4,3-d][1,2]oxazole (PubChem CID 124785457) has the molecular formula C17H15ClN2O4 and a molecular weight of 346.77 g/mol. Its IUPAC name is (3aS,4R,9bS)-4-(4-chlorophenyl)-2-methyl-3a-nitro-4,9b-dihydro-1H-chromeno[4,3-d][1,2]oxazole.
| Compound Name | (3aS,4R,9bS)-4-(4-chlorophenyl)-2-methyl-3a-nitro-4,9b-dihydro-1H-chromeno[4,3-d][1,2]oxazole |
|---|---|
| PubChem CID | 124785457 |
| Molecular Formula | C17H15ClN2O4 |
| Molecular Weight | 346.77 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | (3aS,4R,9bS)-4-(4-chlorophenyl)-2-methyl-3a-nitro-4,9b-dihydro-1H-chromeno[4,3-d][1,2]oxazole |
| SMILES | CN1C[C@@H]2c3ccccc3O[C@H](c3ccc(Cl)cc3)[C@@]2([N+](=O)[O-])O1 |
| InChI | InChI=1S/C17H15ClN2O4/c1-19-10-14-13-4-2-3-5-15(13)23-16(17(14,24-19)20(21)22)11-6-8-12(18)9-7-11/h2-9,14,16H,10H2,1H3/t14-,16-,17+/m1/s1 |
| InChIKey | CAMKNCDHTBFJSA-OIISXLGYSA-N |
| XLogP | 3.41 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.77 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|