C27H20ClN3O3 — CID 71505033
(6S,6aR,10aR)-2-chloro-7-imino-10-methyl-6a-nitro-6,9-diphenyl-10,10a-dihydro-6H-benzo[c]chromene-8-carbonitrile (PubChem CID 71505033) has the molecular formula C27H20ClN3O3 and a molecular weight of 469.93 g/mol. Its IUPAC name is (6S,6aR,10aR)-2-chloro-7-imino-10-methyl-6a-nitro-6,9-diphenyl-10,10a-dihydro-6H-benzo[c]chromene-8-carbonitrile.
| Compound Name | (6S,6aR,10aR)-2-chloro-7-imino-10-methyl-6a-nitro-6,9-diphenyl-10,10a-dihydro-6H-benzo[c]chromene-8-carbonitrile |
|---|---|
| PubChem CID | 71505033 |
| Molecular Formula | C27H20ClN3O3 |
| Molecular Weight | 469.93 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | (6S,6aR,10aR)-2-chloro-7-imino-10-methyl-6a-nitro-6,9-diphenyl-10,10a-dihydro-6H-benzo[c]chromene-8-carbonitrile |
| SMILES | [H]/N=C1\C(C#N)=C(c2ccccc2)C(C)[C@@H]2c3cc(Cl)ccc3O[C@@H](c3ccccc3)[C@]12[N+](=O)[O-] |
| InChI | InChI=1S/C27H20ClN3O3/c1-16-23(17-8-4-2-5-9-17)21(15-29)25(30)27(31(32)33)24(16)20-14-19(28)12-13-22(20)34-26(27)18-10-6-3-7-11-18/h2-14,16,24,26,30H,1H3/b30-25+/t16?,24-,26+,27-/m1/s1 |
| InChIKey | RSZZBQRCVGLUDB-SAYOZCHHSA-N |
| XLogP | 6.22 |
| TPSA | 100.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.93 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|