C16H16N2O — CID 58983139
4-methyl-2-phenyl-8,9-dihydro-3H-1,4-benzodiazepin-5-one (PubChem CID 58983139) has the molecular formula C16H16N2O and a molecular weight of 252.32 g/mol. Its IUPAC name is 4-methyl-2-phenyl-8,9-dihydro-3H-1,4-benzodiazepin-5-one.
| Compound Name | 4-methyl-2-phenyl-8,9-dihydro-3H-1,4-benzodiazepin-5-one |
|---|---|
| PubChem CID | 58983139 |
| Molecular Formula | C16H16N2O |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 4-methyl-2-phenyl-8,9-dihydro-3H-1,4-benzodiazepin-5-one |
| SMILES | CN1CC(c2ccccc2)=NC2=C(C=CCC2)C1=O |
| InChI | InChI=1S/C16H16N2O/c1-18-11-15(12-7-3-2-4-8-12)17-14-10-6-5-9-13(14)16(18)19/h2-5,7-9H,6,10-11H2,1H3 |
| InChIKey | CYDNDPIQGNOAEC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |