C11H13N3O — CID 10954650
1,2-dimethyl-3-phenyl-5H-1,2,4-triazin-6-one (PubChem CID 10954650) has the molecular formula C11H13N3O and a molecular weight of 203.25 g/mol. Its IUPAC name is 1,2-dimethyl-3-phenyl-5H-1,2,4-triazin-6-one.
| Compound Name | 1,2-dimethyl-3-phenyl-5H-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 10954650 |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | 1,2-dimethyl-3-phenyl-5H-1,2,4-triazin-6-one |
| SMILES | CN1C(=O)CN=C(c2ccccc2)N1C |
| InChI | InChI=1S/C11H13N3O/c1-13-10(15)8-12-11(14(13)2)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| InChIKey | SEUGYYSWPNTYSL-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |